C16H30O5 — CID 10494586
ethyl 3-(2,2-diethoxyethyl)-2-(2-hydroxyethyl)-4-methylpent-4-enoate (PubChem CID 10494586) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethyl 3-(2,2-diethoxyethyl)-2-(2-hydroxyethyl)-4-methylpent-4-enoate.
| Compound Name | ethyl 3-(2,2-diethoxyethyl)-2-(2-hydroxyethyl)-4-methylpent-4-enoate |
|---|---|
| PubChem CID | 10494586 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | ethyl 3-(2,2-diethoxyethyl)-2-(2-hydroxyethyl)-4-methylpent-4-enoate |
| SMILES | C=C(C)C(CC(OCC)OCC)C(CCO)C(=O)OCC |
| InChI | InChI=1S/C16H30O5/c1-6-19-15(20-7-2)11-14(12(4)5)13(9-10-17)16(18)21-8-3/h13-15,17H,4,6-11H2,1-3,5H3 |
| InChIKey | TYYNLPZKPLUXPZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|