C20H36O4 — CID 85354286
ethyl 2-(5,5-diethoxy-2-methylpent-1-en-3-yl)-6-methylhept-6-enoate (PubChem CID 85354286) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is ethyl 2-(5,5-diethoxy-2-methylpent-1-en-3-yl)-6-methylhept-6-enoate.
| Compound Name | ethyl 2-(5,5-diethoxy-2-methylpent-1-en-3-yl)-6-methylhept-6-enoate |
|---|---|
| PubChem CID | 85354286 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | ethyl 2-(5,5-diethoxy-2-methylpent-1-en-3-yl)-6-methylhept-6-enoate |
| SMILES | C=C(C)CCCC(C(=O)OCC)C(CC(OCC)OCC)C(=C)C |
| InChI | InChI=1S/C20H36O4/c1-8-22-19(23-9-2)14-18(16(6)7)17(20(21)24-10-3)13-11-12-15(4)5/h17-19H,4,6,8-14H2,1-3,5,7H3 |
| InChIKey | UGXOCNYUETUCMI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|