C15H14FNO2 — CID 104946265
3-[(4R)-4-amino-3,4-dihydro-2H-chromen-2-yl]-5-fluorophenol (PubChem CID 104946265) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-[(4R)-4-amino-3,4-dihydro-2H-chromen-2-yl]-5-fluorophenol.
| Compound Name | 3-[(4R)-4-amino-3,4-dihydro-2H-chromen-2-yl]-5-fluorophenol |
|---|---|
| PubChem CID | 104946265 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[(4R)-4-amino-3,4-dihydro-2H-chromen-2-yl]-5-fluorophenol |
| SMILES | N[C@@H]1CC(c2cc(O)cc(F)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H14FNO2/c16-10-5-9(6-11(18)7-10)15-8-13(17)12-3-1-2-4-14(12)19-15/h1-7,13,15,18H,8,17H2/t13-,15?/m1/s1 |
| InChIKey | QRVSCPWUQRUVFC-AFYYWNPRSA-N |
| XLogP | 3.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |