C13H11ClO2S — CID 104949002
(4S)-6-chloro-2-thiophen-3-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949002) has the molecular formula C13H11ClO2S and a molecular weight of 266.75 g/mol. Its IUPAC name is (4S)-6-chloro-2-thiophen-3-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-chloro-2-thiophen-3-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949002 |
| Molecular Formula | C13H11ClO2S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (4S)-6-chloro-2-thiophen-3-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CC(c2ccsc2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H11ClO2S/c14-9-1-2-12-10(5-9)11(15)6-13(16-12)8-3-4-17-7-8/h1-5,7,11,13,15H,6H2/t11-,13?/m0/s1 |
| InChIKey | SMSNGLDJPHCWEJ-AMGKYWFPSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |