C11H10BrFN2S — CID 104953472
N-[(4-bromothiophen-2-yl)methyl]-1-(5-fluoro-3-pyridinyl)methanamine (PubChem CID 104953472) has the molecular formula C11H10BrFN2S and a molecular weight of 301.18 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-(5-fluoro-3-pyridinyl)methanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-(5-fluoro-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 104953472 |
| Molecular Formula | C11H10BrFN2S |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-(5-fluoro-3-pyridinyl)methanamine |
| SMILES | Fc1cncc(CNCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C11H10BrFN2S/c12-9-2-11(16-7-9)6-15-4-8-1-10(13)5-14-3-8/h1-3,5,7,15H,4,6H2 |
| InChIKey | XJZBQFQMGVEQMH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |