C12H24F2N2O2 — CID 104955597
tert-butyl N-[3-(butan-2-ylamino)-2,2-difluoropropyl]carbamate (PubChem CID 104955597) has the molecular formula C12H24F2N2O2 and a molecular weight of 266.33 g/mol. Its IUPAC name is tert-butyl N-[3-(butan-2-ylamino)-2,2-difluoropropyl]carbamate.
| Compound Name | tert-butyl N-[3-(butan-2-ylamino)-2,2-difluoropropyl]carbamate |
|---|---|
| PubChem CID | 104955597 |
| Molecular Formula | C12H24F2N2O2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | tert-butyl N-[3-(butan-2-ylamino)-2,2-difluoropropyl]carbamate |
| SMILES | CCC(C)NCC(F)(F)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24F2N2O2/c1-6-9(2)15-7-12(13,14)8-16-10(17)18-11(3,4)5/h9,15H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | PNOVMSWYFYUJKA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |