C17H32N2O3 — CID 104955738
tert-butyl 2-methyl-3-[1-(oxolan-3-yl)ethylamino]piperidine-1-carboxylate (PubChem CID 104955738) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is tert-butyl 2-methyl-3-[1-(oxolan-3-yl)ethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-3-[1-(oxolan-3-yl)ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104955738 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | tert-butyl 2-methyl-3-[1-(oxolan-3-yl)ethylamino]piperidine-1-carboxylate |
| SMILES | CC(NC1CCCN(C(=O)OC(C)(C)C)C1C)C1CCOC1 |
| InChI | InChI=1S/C17H32N2O3/c1-12(14-8-10-21-11-14)18-15-7-6-9-19(13(15)2)16(20)22-17(3,4)5/h12-15,18H,6-11H2,1-5H3 |
| InChIKey | FMHKDLFGQRXEFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |