C16H30N2O4 — CID 103904528
tert-butyl (3S)-3-methoxy-4-[1-(oxolan-3-yl)ethylamino]pyrrolidine-1-carboxylate (PubChem CID 103904528) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-methoxy-4-[1-(oxolan-3-yl)ethylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methoxy-4-[1-(oxolan-3-yl)ethylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103904528 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl (3S)-3-methoxy-4-[1-(oxolan-3-yl)ethylamino]pyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC1NC(C)C1CCOC1 |
| InChI | InChI=1S/C16H30N2O4/c1-11(12-6-7-21-10-12)17-13-8-18(9-14(13)20-5)15(19)22-16(2,3)4/h11-14,17H,6-10H2,1-5H3/t11?,12?,13?,14-/m0/s1 |
| InChIKey | IEORSGCWPTZQAS-XOZUOACSSA-N |
| XLogP | 1.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |