C16H31N3O3 — CID 107244847
tert-butyl (4S)-3-[(4-aminocyclohexyl)amino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 107244847) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl (4S)-3-[(4-aminocyclohexyl)amino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[(4-aminocyclohexyl)amino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107244847 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl (4S)-3-[(4-aminocyclohexyl)amino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC1NC1CCC(N)CC1 |
| InChI | InChI=1S/C16H31N3O3/c1-16(2,3)22-15(20)19-9-13(14(10-19)21-4)18-12-7-5-11(17)6-8-12/h11-14,18H,5-10,17H2,1-4H3/t11?,12?,13?,14-/m0/s1 |
| InChIKey | DIDNCQADTMHWOF-XOZUOACSSA-N |
| XLogP | 1.48 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |