C15H30N2O4 — CID 103843166
tert-butyl (3S)-3-methoxy-4-(4-methoxybutan-2-ylamino)pyrrolidine-1-carboxylate (PubChem CID 103843166) has the molecular formula C15H30N2O4 and a molecular weight of 302.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-methoxy-4-(4-methoxybutan-2-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methoxy-4-(4-methoxybutan-2-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103843166 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | tert-butyl (3S)-3-methoxy-4-(4-methoxybutan-2-ylamino)pyrrolidine-1-carboxylate |
| SMILES | COCCC(C)NC1CN(C(=O)OC(C)(C)C)C[C@@H]1OC |
| InChI | InChI=1S/C15H30N2O4/c1-11(7-8-19-5)16-12-9-17(10-13(12)20-6)14(18)21-15(2,3)4/h11-13,16H,7-10H2,1-6H3/t11?,12?,13-/m0/s1 |
| InChIKey | ZQNZSGKFVFCDPX-BPCQOVAHSA-N |
| XLogP | 1.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |