C18H18ClNO2 — CID 10495574
(1S,11R)-7-(4-chlorophenyl)-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one (PubChem CID 10495574) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (1S,11R)-7-(4-chlorophenyl)-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one.
| Compound Name | (1S,11R)-7-(4-chlorophenyl)-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one |
|---|---|
| PubChem CID | 10495574 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (1S,11R)-7-(4-chlorophenyl)-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one |
| SMILES | O=C1CCC2(c3ccc(Cl)cc3)OCC3C([C@@H]4C=C[C@H]3C4)N12 |
| InChI | InChI=1S/C18H18ClNO2/c19-14-5-3-13(4-6-14)18-8-7-16(21)20(18)17-12-2-1-11(9-12)15(17)10-22-18/h1-6,11-12,15,17H,7-10H2/t11-,12+,15?,17?,18?/m0/s1 |
| InChIKey | DDTNZKKVDIOZMU-XCRUDSDTSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|