C12H17N3O3 — CID 104956902
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 104956902) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 104956902 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1cccnc1=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H17N3O3/c16-10-5-2-1-4-9(10)14-11(17)8-15-7-3-6-13-12(15)18/h3,6-7,9-10,16H,1-2,4-5,8H2,(H,14,17)/t9-,10-/m0/s1 |
| InChIKey | ZLFVVKJLJZFJOH-UWVGGRQHSA-N |
| XLogP | -0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |