C16H19N3O2S — CID 39613297
N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 39613297) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-2-(2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-2-(2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 39613297 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1cccnc1=O)N[C@H](c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C16H19N3O2S/c20-14(11-19-9-4-8-17-16(19)21)18-15(12-5-1-2-6-12)13-7-3-10-22-13/h3-4,7-10,12,15H,1-2,5-6,11H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | DJYOXUZYYMVTQL-HNNXBMFYSA-N |
| XLogP | 2.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |