C15H24N2O3S — CID 104959241
1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]propan-1-amine (PubChem CID 104959241) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]propan-1-amine.
| Compound Name | 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]propan-1-amine |
|---|---|
| PubChem CID | 104959241 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]propan-1-amine |
| SMILES | CCC(N)c1cccc(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-4-15(16)13-6-5-7-14(8-13)21(18,19)17-9-11(2)20-12(3)10-17/h5-8,11-12,15H,4,9-10,16H2,1-3H3/t11-,12+,15? |
| InChIKey | SZCOLXOFSRLXEX-ODOQXGPZSA-N |
| XLogP | 1.89 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |