C14H26BrNO — CID 104959997
(2R,6S)-4-[[1-(bromomethyl)cyclohexyl]methyl]-2,6-dimethylmorpholine (PubChem CID 104959997) has the molecular formula C14H26BrNO and a molecular weight of 304.27 g/mol. Its IUPAC name is (2R,6S)-4-[[1-(bromomethyl)cyclohexyl]methyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[[1-(bromomethyl)cyclohexyl]methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 104959997 |
| Molecular Formula | C14H26BrNO |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (2R,6S)-4-[[1-(bromomethyl)cyclohexyl]methyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(CC2(CBr)CCCCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H26BrNO/c1-12-8-16(9-13(2)17-12)11-14(10-15)6-4-3-5-7-14/h12-13H,3-11H2,1-2H3/t12-,13+ |
| InChIKey | ATJGBUVOWOJOTL-BETUJISGSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|