C17H19NO3 — CID 104962060
(1S,6R)-6-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962060) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1S,6R)-6-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962060 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1S,6R)-6-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCC1Cc2ccccc21 |
| InChI | InChI=1S/C17H19NO3/c19-16(14-7-3-4-8-15(14)17(20)21)18-10-12-9-11-5-1-2-6-13(11)12/h1-6,12,14-15H,7-10H2,(H,18,19)(H,20,21)/t12?,14-,15+/m1/s1 |
| InChIKey | SQGFCGZLJAFXJF-UCWKZMIHSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|