C15H23NO3 — CID 104962435
(1S,6R)-6-[cyclopentylmethyl(methyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962435) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (1S,6R)-6-[cyclopentylmethyl(methyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[cyclopentylmethyl(methyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962435 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (1S,6R)-6-[cyclopentylmethyl(methyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CN(CC1CCCC1)C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H23NO3/c1-16(10-11-6-2-3-7-11)14(17)12-8-4-5-9-13(12)15(18)19/h4-5,11-13H,2-3,6-10H2,1H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | GHKCMFDCHMJTIG-OLZOCXBDSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|