C15H25NO3 — CID 63783865
4-[cyclopentylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 63783865) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[cyclopentylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[cyclopentylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63783865 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-[cyclopentylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(CC1CCCC1)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H25NO3/c1-16(10-11-4-2-3-5-11)14(17)12-6-8-13(9-7-12)15(18)19/h11-13H,2-10H2,1H3,(H,18,19) |
| InChIKey | LMQKGNDMNVQCCF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |