C16H24N2O3 — CID 104962540
(1S,6R)-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962540) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1S,6R)-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962540 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1S,6R)-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CN1C2CCC1CN(C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O)CC2 |
| InChI | InChI=1S/C16H24N2O3/c1-17-11-6-7-12(17)10-18(9-8-11)15(19)13-4-2-3-5-14(13)16(20)21/h2-3,11-14H,4-10H2,1H3,(H,20,21)/t11?,12?,13-,14+/m1/s1 |
| InChIKey | CKVUYIHVGBKERV-PQAZSJQKSA-N |
| XLogP | 1.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|