C12H18Cl2N2O — CID 129422315
[(1S)-2,2-dichlorocyclopropyl]-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methanone (PubChem CID 129422315) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.19 g/mol. Its IUPAC name is [(1S)-2,2-dichlorocyclopropyl]-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methanone.
| Compound Name | [(1S)-2,2-dichlorocyclopropyl]-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 129422315 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [(1S)-2,2-dichlorocyclopropyl]-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methanone |
| SMILES | CN1[C@H]2CC[C@H]1CN(C(=O)[C@@H]1CC1(Cl)Cl)CC2 |
| InChI | InChI=1S/C12H18Cl2N2O/c1-15-8-2-3-9(15)7-16(5-4-8)11(17)10-6-12(10,13)14/h8-10H,2-7H2,1H3/t8-,9-,10-/m0/s1 |
| InChIKey | JJRAQJFZTGKXFJ-GUBZILKMSA-N |
| XLogP | 1.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|