C9H15Cl3N2O — CID 130874964
(3-aminopiperidin-1-yl)-(2,2-dichlorocyclopropyl)methanone;hydrochloride (PubChem CID 130874964) has the molecular formula C9H15Cl3N2O and a molecular weight of 273.59 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2,2-dichlorocyclopropyl)methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(2,2-dichlorocyclopropyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 130874964 |
| Molecular Formula | C9H15Cl3N2O |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2,2-dichlorocyclopropyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)C2CC2(Cl)Cl)C1 |
| InChI | InChI=1S/C9H14Cl2N2O.ClH/c10-9(11)4-7(9)8(14)13-3-1-2-6(12)5-13;/h6-7H,1-5,12H2;1H |
| InChIKey | LAUIIONGZJFGGX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|