C13H21NO3S — CID 104962733
(1S,6R)-6-(4-methylsulfanylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962733) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is (1S,6R)-6-(4-methylsulfanylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(4-methylsulfanylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962733 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (1S,6R)-6-(4-methylsulfanylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CSCCCCNC(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H21NO3S/c1-18-9-5-4-8-14-12(15)10-6-2-3-7-11(10)13(16)17/h2-3,10-11H,4-9H2,1H3,(H,14,15)(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | KRADFURNGXWUHM-MNOVXSKESA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|