C13H21NO4 — CID 104962747
(1S,6R)-6-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962747) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (1S,6R)-6-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962747 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (1S,6R)-6-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)(CCO)NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H21NO4/c1-13(2,7-8-15)14-11(16)9-5-3-4-6-10(9)12(17)18/h3-4,9-10,15H,5-8H2,1-2H3,(H,14,16)(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | JSNQWPOVUQDTAG-ZJUUUORDSA-N |
| XLogP | 0.93 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|