C15H20N2O4 — CID 104963087
(1S,6R)-6-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104963087) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1S,6R)-6-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104963087 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (1S,6R)-6-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(c2noc([C@@H]3CC=CC[C@@H]3C(=O)O)n2)CCCCO1 |
| InChI | InChI=1S/C15H20N2O4/c1-15(8-4-5-9-20-15)14-16-12(21-17-14)10-6-2-3-7-11(10)13(18)19/h2-3,10-11H,4-9H2,1H3,(H,18,19)/t10-,11+,15?/m1/s1 |
| InChIKey | HBHPBUFSPFIQHW-SPJRPDJQSA-N |
| XLogP | 2.62 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|