C12H18N2O4 — CID 106474174
3-[3-(2-methyloxolan-2-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol (PubChem CID 106474174) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[3-(2-methyloxolan-2-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol.
| Compound Name | 3-[3-(2-methyloxolan-2-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
|---|---|
| PubChem CID | 106474174 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[3-(2-methyloxolan-2-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
| SMILES | CC1(c2noc(C3COCCC3O)n2)CCCO1 |
| InChI | InChI=1S/C12H18N2O4/c1-12(4-2-5-17-12)11-13-10(18-14-11)8-7-16-6-3-9(8)15/h8-9,15H,2-7H2,1H3 |
| InChIKey | GLPCTHIMBUCYBF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |