C14H19NO5 — CID 104964462
(2S,3R)-2-[[2-(3-ethylphenoxy)acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 104964462) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S,3R)-2-[[2-(3-ethylphenoxy)acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[2-(3-ethylphenoxy)acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104964462 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2S,3R)-2-[[2-(3-ethylphenoxy)acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCc1cccc(OCC(=O)N[C@H](C(=O)O)[C@@H](C)O)c1 |
| InChI | InChI=1S/C14H19NO5/c1-3-10-5-4-6-11(7-10)20-8-12(17)15-13(9(2)16)14(18)19/h4-7,9,13,16H,3,8H2,1-2H3,(H,15,17)(H,18,19)/t9-,13+/m1/s1 |
| InChIKey | ZSMSIDZPAWLFIJ-RNCFNFMXSA-N |
| XLogP | 0.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |