C12H16N2O4 — CID 104965238
(2S,3R)-2-[(2-anilinoacetyl)amino]-3-hydroxybutanoic acid (PubChem CID 104965238) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2S,3R)-2-[(2-anilinoacetyl)amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(2-anilinoacetyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965238 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2S,3R)-2-[(2-anilinoacetyl)amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)CNc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O4/c1-8(15)11(12(17)18)14-10(16)7-13-9-5-3-2-4-6-9/h2-6,8,11,13,15H,7H2,1H3,(H,14,16)(H,17,18)/t8-,11+/m1/s1 |
| InChIKey | VMYIJXOEQPJGOU-KCJUWKMLSA-N |
| XLogP | 0.05 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |