C13H21N3O5S — CID 10496721
[(E)-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylideneamino]thiourea (PubChem CID 10496721) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is [(E)-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 10496721 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(E)-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylideneamino]thiourea |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](/C=N/NC(N)=S)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H21N3O5S/c1-12(2)18-7-6(5-15-16-11(14)22)17-10-9(8(7)19-12)20-13(3,4)21-10/h5-10H,1-4H3,(H3,14,16,22)/b15-5+/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | WHSKTYRNNNZSSY-CNIFOSDLSA-N |
| XLogP | 0.20 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|