C18H26N2O — CID 104967543
[(2S,6R)-2,6-dimethylpiperidin-1-yl]-(2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 104967543) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 104967543 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | CC1CC(C(=O)N2[C@H](C)CCC[C@@H]2C)c2ccccc2N1 |
| InChI | InChI=1S/C18H26N2O/c1-12-11-16(15-9-4-5-10-17(15)19-12)18(21)20-13(2)7-6-8-14(20)3/h4-5,9-10,12-14,16,19H,6-8,11H2,1-3H3/t12?,13-,14+,16? |
| InChIKey | ZEGKZKBCWYWSLX-MHXRYWECSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |