C19H28N2O — CID 43823060
N-cyclooctyl-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide (PubChem CID 43823060) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-cyclooctyl-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide.
| Compound Name | N-cyclooctyl-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 43823060 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-cyclooctyl-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
| SMILES | CC1CC(C(=O)NC2CCCCCCC2)c2ccccc2N1 |
| InChI | InChI=1S/C19H28N2O/c1-14-13-17(16-11-7-8-12-18(16)20-14)19(22)21-15-9-5-3-2-4-6-10-15/h7-8,11-12,14-15,17,20H,2-6,9-10,13H2,1H3,(H,21,22) |
| InChIKey | IJBWCLMWQJDIRV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |