C14H20N4O2 — CID 83120583
N-[2-(carbamoylamino)ethyl]-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide (PubChem CID 83120583) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 83120583 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
| SMILES | CC1CC(C(=O)NCCNC(N)=O)c2ccccc2N1 |
| InChI | InChI=1S/C14H20N4O2/c1-9-8-11(10-4-2-3-5-12(10)18-9)13(19)16-6-7-17-14(15)20/h2-5,9,11,18H,6-8H2,1H3,(H,16,19)(H3,15,17,20) |
| InChIKey | BNAKUPNVTJOPHH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|