About 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol
2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol (PubChem CID 104969044) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol |
| PubChem CID | 104969044 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol |
| SMILES | CC(CO)S(=O)(=O)N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C10H21NO3S/c1-8-5-4-6-9(2)11(8)15(13,14)10(3)7-12/h8-10,12H,4-7H2,1-3H3/t8-,9+,10? |
| InChIKey | UVTSOKGXWIPCLZ-ULKQDVFKSA-N |
| XLogP | 0.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol?
The IUPAC name of 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol (CID 104969044) is 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol.
What is the SMILES notation for 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol?
The canonical SMILES for 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol is CC(CO)S(=O)(=O)N1[C@H](C)CCC[C@@H]1C.
What is the InChIKey of 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol?
The InChIKey is UVTSOKGXWIPCLZ-ULKQDVFKSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-8-5-4-6-9(2)11(8)15(13,14)10(3)7-12/h8-10,12H,4-7H2,1-3H3/t8-,9+,10?.
What are the key properties of 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol?
2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol has a molecular weight of 235.35 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpropan-1-ol is sourced from PubChem (CID 104969044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).