C10H20N2O2 — CID 104969353
2-(dimethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 104969353) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 104969353 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-(dimethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | CN(C)CC(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H20N2O2/c1-12(2)7-10(14)11-8-5-3-4-6-9(8)13/h8-9,13H,3-7H2,1-2H3,(H,11,14)/t8-,9-/m0/s1 |
| InChIKey | KIHZOOIOCAJYSQ-IUCAKERBSA-N |
| XLogP | -0.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |