C15H27F3INO3 — CID 104969743
tert-butyl N-ethyl-N-[3-iodo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate (PubChem CID 104969743) has the molecular formula C15H27F3INO3 and a molecular weight of 453.28 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[3-iodo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[3-iodo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate |
|---|---|
| PubChem CID | 104969743 |
| Molecular Formula | C15H27F3INO3 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | tert-butyl N-ethyl-N-[3-iodo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate |
| SMILES | CCN(CC(C)(CI)OCCCC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27F3INO3/c1-6-20(12(21)23-13(2,3)4)11-14(5,10-19)22-9-7-8-15(16,17)18/h6-11H2,1-5H3 |
| InChIKey | IPWONTUSCDKTMW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|