About 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate
1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate (PubChem CID 10497101) has the molecular formula C21H24N2O2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate |
| PubChem CID | 10497101 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)OC1CN2CCC1CC2 |
| InChI | InChI=1S/C21H24N2O2/c24-21(25-19-15-23-13-11-16(19)12-14-23)22-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,16,19-20H,11-15H2,(H,22,24) |
| InChIKey | FVIWHTVYXWHHSP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate (CID 10497101) is 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate is O=C(NC(c1ccccc1)c1ccccc1)OC1CN2CCC1CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate?
The InChIKey is FVIWHTVYXWHHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2/c24-21(25-19-15-23-13-11-16(19)12-14-23)22-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,16,19-20H,11-15H2,(H,22,24).
What are the key properties of 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate?
1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate has a molecular weight of 336.44 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-yl N-benzhydrylcarbamate is sourced from PubChem (CID 10497101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).