C8H12ClN3S — CID 104973704
1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine (PubChem CID 104973704) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine.
| Compound Name | 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 104973704 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(Cc2ncc(Cl)s2)C1 |
| InChI | InChI=1S/C8H12ClN3S/c9-7-3-11-8(13-7)5-12-2-1-6(10)4-12/h3,6H,1-2,4-5,10H2 |
| InChIKey | RGBOKJQOAWCPBF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |