About 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine
1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine (PubChem CID 104973704) has the molecular formula C8H12ClN3S
and a molecular weight of 217.72 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine |
| PubChem CID | 104973704 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(Cc2ncc(Cl)s2)C1 |
| InChI | InChI=1S/C8H12ClN3S/c9-7-3-11-8(13-7)5-12-2-1-6(10)4-12/h3,6H,1-2,4-5,10H2 |
| InChIKey | RGBOKJQOAWCPBF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine?
The IUPAC name of 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine (CID 104973704) is 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine.
What is the SMILES notation for 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine?
The canonical SMILES for 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine is NC1CCN(Cc2ncc(Cl)s2)C1.
What is the InChIKey of 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine?
The InChIKey is RGBOKJQOAWCPBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3S/c9-7-3-11-8(13-7)5-12-2-1-6(10)4-12/h3,6H,1-2,4-5,10H2.
What are the key properties of 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine?
1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine has a molecular weight of 217.72 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrrolidin-3-amine is sourced from PubChem (CID 104973704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).