C13H20ClN3O — CID 104974783
(4-chloro-1-propan-2-ylpyrrol-2-yl)-[(3R)-3-methylpiperazin-1-yl]methanone (PubChem CID 104974783) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrrol-2-yl)-[(3R)-3-methylpiperazin-1-yl]methanone.
| Compound Name | (4-chloro-1-propan-2-ylpyrrol-2-yl)-[(3R)-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 104974783 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrrol-2-yl)-[(3R)-3-methylpiperazin-1-yl]methanone |
| SMILES | CC(C)n1cc(Cl)cc1C(=O)N1CCN[C@H](C)C1 |
| InChI | InChI=1S/C13H20ClN3O/c1-9(2)17-8-11(14)6-12(17)13(18)16-5-4-15-10(3)7-16/h6,8-10,15H,4-5,7H2,1-3H3/t10-/m1/s1 |
| InChIKey | PQZJRVXIELGBHV-SNVBAGLBSA-N |
| XLogP | 2.16 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |