C15H22BrN3O — CID 104975216
N-[(2-bromophenyl)methyl]-N-methyl-2-[(3R)-3-methylpiperazin-1-yl]acetamide (PubChem CID 104975216) has the molecular formula C15H22BrN3O and a molecular weight of 340.26 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-methyl-2-[(3R)-3-methylpiperazin-1-yl]acetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N-methyl-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 104975216 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-methyl-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
| SMILES | C[C@@H]1CN(CC(=O)N(C)Cc2ccccc2Br)CCN1 |
| InChI | InChI=1S/C15H22BrN3O/c1-12-9-19(8-7-17-12)11-15(20)18(2)10-13-5-3-4-6-14(13)16/h3-6,12,17H,7-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | LPRSZYXKPVKXIY-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |