C17H26BrN3O — CID 120728275
2-[3-(2-aminoethyl)piperidin-1-yl]-N-[(2-bromophenyl)methyl]-N-methylacetamide (PubChem CID 120728275) has the molecular formula C17H26BrN3O and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)piperidin-1-yl]-N-[(2-bromophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[3-(2-aminoethyl)piperidin-1-yl]-N-[(2-bromophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 120728275 |
| Molecular Formula | C17H26BrN3O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[3-(2-aminoethyl)piperidin-1-yl]-N-[(2-bromophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CN1CCCC(CCN)C1 |
| InChI | InChI=1S/C17H26BrN3O/c1-20(12-15-6-2-3-7-16(15)18)17(22)13-21-10-4-5-14(11-21)8-9-19/h2-3,6-7,14H,4-5,8-13,19H2,1H3 |
| InChIKey | OWRGXKZPXGQQJN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |