C12H17BrN4O — CID 104975239
N-(5-bromo-2-pyridinyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide (PubChem CID 104975239) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 104975239 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
| SMILES | C[C@@H]1CN(CC(=O)Nc2ccc(Br)cn2)CCN1 |
| InChI | InChI=1S/C12H17BrN4O/c1-9-7-17(5-4-14-9)8-12(18)16-11-3-2-10(13)6-15-11/h2-3,6,9,14H,4-5,7-8H2,1H3,(H,15,16,18)/t9-/m1/s1 |
| InChIKey | ZBLNLQYMLGVZCE-SECBINFHSA-N |
| XLogP | 1.08 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |