C12H25N3O — CID 104975433
2-[(3R)-3-methylpiperazin-1-yl]-N-pentan-2-ylacetamide (PubChem CID 104975433) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(3R)-3-methylpiperazin-1-yl]-N-pentan-2-ylacetamide.
| Compound Name | 2-[(3R)-3-methylpiperazin-1-yl]-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 104975433 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 2-[(3R)-3-methylpiperazin-1-yl]-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CN1CCN[C@H](C)C1 |
| InChI | InChI=1S/C12H25N3O/c1-4-5-10(2)14-12(16)9-15-7-6-13-11(3)8-15/h10-11,13H,4-9H2,1-3H3,(H,14,16)/t10?,11-/m1/s1 |
| InChIKey | MCCXGUGKQUINPP-RRKGBCIJSA-N |
| XLogP | 0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |