C11H23N3O2 — CID 65448068
N-(1-methoxypropan-2-yl)-2-(3-methylpiperazin-1-yl)acetamide (PubChem CID 65448068) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-2-(3-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(1-methoxypropan-2-yl)-2-(3-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 65448068 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-2-(3-methylpiperazin-1-yl)acetamide |
| SMILES | COCC(C)NC(=O)CN1CCNC(C)C1 |
| InChI | InChI=1S/C11H23N3O2/c1-9-6-14(5-4-12-9)7-11(15)13-10(2)8-16-3/h9-10,12H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | GPGXTKYHMGPHFC-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |