C8H15F3N2 — CID 104975435
(3R)-3-methyl-1-(3,3,3-trifluoropropyl)piperazine (PubChem CID 104975435) has the molecular formula C8H15F3N2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (3R)-3-methyl-1-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | (3R)-3-methyl-1-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 104975435 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (3R)-3-methyl-1-(3,3,3-trifluoropropyl)piperazine |
| SMILES | C[C@@H]1CN(CCC(F)(F)F)CCN1 |
| InChI | InChI=1S/C8H15F3N2/c1-7-6-13(5-3-12-7)4-2-8(9,10)11/h7,12H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | QBWBVOCZMWMKBA-SSDOTTSWSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |