C11H21N3 — CID 131010612
1-[2-(2,5-dihydropyrrol-1-yl)ethyl]-3-methylpiperazine (PubChem CID 131010612) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[2-(2,5-dihydropyrrol-1-yl)ethyl]-3-methylpiperazine.
| Compound Name | 1-[2-(2,5-dihydropyrrol-1-yl)ethyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 131010612 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-[2-(2,5-dihydropyrrol-1-yl)ethyl]-3-methylpiperazine |
| SMILES | CC1CN(CCN2CC=CC2)CCN1 |
| InChI | InChI=1S/C11H21N3/c1-11-10-14(7-4-12-11)9-8-13-5-2-3-6-13/h2-3,11-12H,4-10H2,1H3 |
| InChIKey | ZMDJMYIYOKZYDN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|