C12H26N4O3S — CID 104978257
2-(tert-butylsulfamoylamino)-2-cyclohexyl-N'-hydroxyethanimidamide (PubChem CID 104978257) has the molecular formula C12H26N4O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)-2-cyclohexyl-N'-hydroxyethanimidamide.
| Compound Name | 2-(tert-butylsulfamoylamino)-2-cyclohexyl-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104978257 |
| Molecular Formula | C12H26N4O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)-2-cyclohexyl-N'-hydroxyethanimidamide |
| SMILES | CC(C)(C)NS(=O)(=O)NC(C(N)=NO)C1CCCCC1 |
| InChI | InChI=1S/C12H26N4O3S/c1-12(2,3)16-20(18,19)15-10(11(13)14-17)9-7-5-4-6-8-9/h9-10,15-17H,4-8H2,1-3H3,(H2,13,14) |
| InChIKey | CXOWSKQQZPZORN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|