C10H19F3N4O3S — CID 104978259
2-cyclohexyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide (PubChem CID 104978259) has the molecular formula C10H19F3N4O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-cyclohexyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclohexyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104978259 |
| Molecular Formula | C10H19F3N4O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-cyclohexyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
| SMILES | NC(=NO)C(NS(=O)(=O)NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H19F3N4O3S/c11-10(12,13)6-15-21(19,20)17-8(9(14)16-18)7-4-2-1-3-5-7/h7-8,15,17-18H,1-6H2,(H2,14,16) |
| InChIKey | NFNIYBOMTBRKDQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|