C11H22N4O3S — CID 104978255
2-cyclohexyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide (PubChem CID 104978255) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-cyclohexyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide.
| Compound Name | 2-cyclohexyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104978255 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-cyclohexyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide |
| SMILES | NC(=NO)C(NS(=O)(=O)NC1CC1)C1CCCCC1 |
| InChI | InChI=1S/C11H22N4O3S/c12-11(13-16)10(8-4-2-1-3-5-8)15-19(17,18)14-9-6-7-9/h8-10,14-16H,1-7H2,(H2,12,13) |
| InChIKey | VWPADRNCYDBXGI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|