C7H15F3N4O3S — CID 104978279
N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)pentanimidamide (PubChem CID 104978279) has the molecular formula C7H15F3N4O3S and a molecular weight of 292.28 g/mol. Its IUPAC name is N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)pentanimidamide.
| Compound Name | N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)pentanimidamide |
|---|---|
| PubChem CID | 104978279 |
| Molecular Formula | C7H15F3N4O3S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)pentanimidamide |
| SMILES | CCCC(NS(=O)(=O)NCC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C7H15F3N4O3S/c1-2-3-5(6(11)13-15)14-18(16,17)12-4-7(8,9)10/h5,12,14-15H,2-4H2,1H3,(H2,11,13) |
| InChIKey | ZDAMETSCXOTTMK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|