C7H13F3N4O3S — CID 104978525
2-cyclopropyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide (PubChem CID 104978525) has the molecular formula C7H13F3N4O3S and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-cyclopropyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclopropyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104978525 |
| Molecular Formula | C7H13F3N4O3S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-cyclopropyl-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)ethanimidamide |
| SMILES | NC(=NO)C(NS(=O)(=O)NCC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C7H13F3N4O3S/c8-7(9,10)3-12-18(16,17)14-5(4-1-2-4)6(11)13-15/h4-5,12,14-15H,1-3H2,(H2,11,13) |
| InChIKey | TYGAYCDMTLDGBI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|