C8H18N4O3S — CID 104978527
2-cyclopropyl-N'-hydroxy-2-(propan-2-ylsulfamoylamino)ethanimidamide (PubChem CID 104978527) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-cyclopropyl-N'-hydroxy-2-(propan-2-ylsulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclopropyl-N'-hydroxy-2-(propan-2-ylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104978527 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-cyclopropyl-N'-hydroxy-2-(propan-2-ylsulfamoylamino)ethanimidamide |
| SMILES | CC(C)NS(=O)(=O)NC(C(N)=NO)C1CC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-5(2)11-16(14,15)12-7(6-3-4-6)8(9)10-13/h5-7,11-13H,3-4H2,1-2H3,(H2,9,10) |
| InChIKey | GUVHSXWNRZJETQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|